CAS 1354427-47-6 is the registry number for rel-2-((1R,5S,6S)-3-azabicyclo[3.1.0]hexan-6-yl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]ethanol (CAS 1354427-47-6) is a chemical compound with the molecular formula C7H13NO and a molecular weight of 127.18 g/mol. IUPAC name: 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]ethanol. InChIKey: DAOXQJXKDWVZTK-DGUCWDHESA-N.
| Molecular formula | C7H13NO |
|---|---|
| Molecular weight | 127.18 g/mol |
| IUPAC name | 2-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]ethanol |
| InChIKey | DAOXQJXKDWVZTK-DGUCWDHESA-N |
| SMILES | C1[C@@H]2[C@@H](C2CCO)CN1 |
Computed by PubChem (NCBI)