CAS 135447-09-5 appears in our catalog under these names: 2-[2-(Di-n-octylamino)-2-oxoethoxy]acetic acid, 95%, 2-(2-(Dioctylamino)-2-oxoethoxy)acetic acid, 98%, N,N–Di–n–octyl–3–oxapentanedioic Acid Monoamide, N,N-Di-n-octyl-3-oxapentanedioic Acid Monoamide, >98.0%(GC)(T), 2-(2-(Dioctylamino)-2-oxoethoxy)acetic acid, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg, 25g.
2-[2-(dioctylamino)-2-oxoethoxy]acetic acid (CAS 135447-09-5) is a chemical compound with the molecular formula C20H39NO4 and a molecular weight of 357.5 g/mol. IUPAC name: 2-[2-(dioctylamino)-2-oxoethoxy]acetic acid. InChIKey: KOHUSHSNNOEPFN-UHFFFAOYSA-N.
| Molecular formula | C20H39NO4 |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | 2-[2-(dioctylamino)-2-oxoethoxy]acetic acid |
| InChIKey | KOHUSHSNNOEPFN-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)COCC(=O)O |
Computed by PubChem (NCBI)