CAS 1354485-02-1 is the registry number for [(3S,4R)-1-Benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
[(3S,4R)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methanol (CAS 1354485-02-1) is a chemical compound with the molecular formula C18H20FNO and a molecular weight of 285.4 g/mol. IUPAC name: [(3S,4R)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methanol. InChIKey: XIVYMLCUZKNTGQ-WMZOPIPTSA-N.
| Molecular formula | C18H20FNO |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | [(3S,4R)-1-benzyl-4-(3-fluorophenyl)pyrrolidin-3-yl]methanol |
| InChIKey | XIVYMLCUZKNTGQ-WMZOPIPTSA-N |
| SMILES | C1[C@H]([C@@H](CN1CC2=CC=CC=C2)C3=CC(=CC=C3)F)CO |
Computed by PubChem (NCBI)