CAS 1354490-36-0 is the registry number for Methyl 3-acetamido-2-chloro-2,3-dideoxy-a-D-altropyranoside. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg.
Methyl (2S,4S)-4-(2-methoxyacetyl)oxypyrrolidine-2-carboxylate;hydrochloride (CAS 1354490-36-0) is a chemical compound with the molecular formula C9H16ClNO5 and a molecular weight of 253.68 g/mol. IUPAC name: methyl (2S,4S)-4-(2-methoxyacetyl)oxypyrrolidine-2-carboxylate;hydrochloride. InChIKey: UCPRTBCWPPSULS-LEUCUCNGSA-N.
| Molecular formula | C9H16ClNO5 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | methyl (2S,4S)-4-(2-methoxyacetyl)oxypyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | UCPRTBCWPPSULS-LEUCUCNGSA-N |
| SMILES | COCC(=O)O[C@H]1C[C@H](NC1)C(=O)OC.Cl |
Computed by PubChem (NCBI)