Products 135459-90-4
CAS 135459-90-4 is the registry number for Ranelic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[bis(carboxymethyl)amino]-3-(carboxymethyl)-4-cyanothiophene-2-carboxylic acid (CAS 135459-90-4) is a chemical compound with the molecular formula C12H10N2O8S and a molecular weight of 342.28 g/mol. IUPAC name: 5-[bis(carboxymethyl)amino]-3-(carboxymethyl)-4-cyanothiophene-2-carboxylic acid. InChIKey: DJSXNILVACEBLP-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O8S |
|---|---|
| Molecular weight | 342.28 g/mol |
| IUPAC name | 5-[bis(carboxymethyl)amino]-3-(carboxymethyl)-4-cyanothiophene-2-carboxylic acid |
| InChIKey | DJSXNILVACEBLP-UHFFFAOYSA-N |
| SMILES | C(C1=C(SC(=C1C#N)N(CC(=O)O)CC(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)