Products 1354695-84-3
CAS 1354695-84-3 appears in our catalog under these names: Entecavir Impurity 63, Entecavir Impurity 49. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-amino-9-[(1R,3R,4R)-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-1H-purin-6-one (CAS 1354695-84-3) is a chemical compound with the molecular formula C26H27N5O3 and a molecular weight of 457.5 g/mol. IUPAC name: 2-amino-9-[(1R,3R,4R)-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-1H-purin-6-one. InChIKey: KROVOOOAPHSWCR-BHDDXSALSA-N.
| Molecular formula | C26H27N5O3 |
|---|---|
| Molecular weight | 457.5 g/mol |
| IUPAC name | 2-amino-9-[(1R,3R,4R)-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-1H-purin-6-one |
| InChIKey | KROVOOOAPHSWCR-BHDDXSALSA-N |
| SMILES | C=C1[C@@H](C[C@H]([C@H]1COCC2=CC=CC=C2)OCC3=CC=CC=C3)N4C=NC5=C4N=C(NC5=O)N |
Computed by PubChem (NCBI)