CAS 1622425-52-8 appears in our catalog under these names: Vilazodone Impurity A(Vilazodone N-Oxide), Vilazodone N-Oxide. Offered by: Chemat Brand. Available pack sizes: on request.
5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]-4-oxidopiperazin-4-ium-1-yl]-1-benzofuran-2-carboxamide (CAS 1622425-52-8) is a chemical compound with the molecular formula C26H27N5O3 and a molecular weight of 457.5 g/mol. IUPAC name: 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]-4-oxidopiperazin-4-ium-1-yl]-1-benzofuran-2-carboxamide. InChIKey: DKWPFIBBZGAEFR-UHFFFAOYSA-N.
| Molecular formula | C26H27N5O3 |
|---|---|
| Molecular weight | 457.5 g/mol |
| IUPAC name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]-4-oxidopiperazin-4-ium-1-yl]-1-benzofuran-2-carboxamide |
| InChIKey | DKWPFIBBZGAEFR-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCN1C2=CC3=C(C=C2)OC(=C3)C(=O)N)(CCCCC4=CNC5=C4C=C(C=C5)C#N)[O-] |
Computed by PubChem (NCBI)