CAS 1354715-30-2 appears in our catalog under these names: Entecavir Impurity 58, Entecavir Impurity 34, Entecavir Impurity 45. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Tert-butyl N-[6-chloro-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]purin-2-yl]carbamate (CAS 1354715-30-2) is a chemical compound with the molecular formula C17H22ClN5O4 and a molecular weight of 395.8 g/mol. IUPAC name: tert-butyl N-[6-chloro-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]purin-2-yl]carbamate. InChIKey: KWCLFRSKTVJCQY-DCAQKATOSA-N.
| Molecular formula | C17H22ClN5O4 |
|---|---|
| Molecular weight | 395.8 g/mol |
| IUPAC name | tert-butyl N-[6-chloro-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]purin-2-yl]carbamate |
| InChIKey | KWCLFRSKTVJCQY-DCAQKATOSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC2=C(C(=N1)Cl)N=CN2[C@H]3C[C@@H]([C@H](C3=C)CO)O |
Computed by PubChem (NCBI)