CAS 1354745-52-0 appears in our catalog under these names: Elq-300, 95%, ELQ-300/ 98.21% (existing batch purity), ELQ-300, ELQ-300 98%, ELQ-300, 98%, 98%. Offered by: Combi-blocks, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg.
6-chloro-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-quinolin-4-one (CAS 1354745-52-0) is a chemical compound with the molecular formula C24H17ClF3NO4 and a molecular weight of 475.8 g/mol. IUPAC name: 6-chloro-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-quinolin-4-one. InChIKey: WZDNKHCQIZRDKW-UHFFFAOYSA-N.
| Molecular formula | C24H17ClF3NO4 |
|---|---|
| Molecular weight | 475.8 g/mol |
| IUPAC name | 6-chloro-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-quinolin-4-one |
| InChIKey | WZDNKHCQIZRDKW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=CC(=C(C=C2N1)OC)Cl)C3=CC=C(C=C3)OC4=CC=C(C=C4)OC(F)(F)F |
Computed by PubChem (NCBI)