CAS 1354745-69-9 is the registry number for ELQ-316. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-fluoro-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-quinolin-4-one (CAS 1354745-69-9) is a chemical compound with the molecular formula C24H17F4NO4 and a molecular weight of 459.4 g/mol. IUPAC name: 6-fluoro-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-quinolin-4-one. InChIKey: SUFFMIUELDDRLM-UHFFFAOYSA-N.
| Molecular formula | C24H17F4NO4 |
|---|---|
| Molecular weight | 459.4 g/mol |
| IUPAC name | 6-fluoro-7-methoxy-2-methyl-3-[4-[4-(trifluoromethoxy)phenoxy]phenyl]-1H-quinolin-4-one |
| InChIKey | SUFFMIUELDDRLM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=CC(=C(C=C2N1)OC)F)C3=CC=C(C=C3)OC4=CC=C(C=C4)OC(F)(F)F |
Computed by PubChem (NCBI)