CAS 1354892-73-1 is the registry number for 3,5-Dimethoxybenzaldehyde-d6. Offered by: TRC. Available pack sizes: 50mg.
3,5-bis(trideuteriomethoxy)benzaldehyde (CAS 1354892-73-1) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 172.21 g/mol. IUPAC name: 3,5-bis(trideuteriomethoxy)benzaldehyde. InChIKey: VFZRZRDOXPRTSC-WFGJKAKNSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 172.21 g/mol |
| IUPAC name | 3,5-bis(trideuteriomethoxy)benzaldehyde |
| InChIKey | VFZRZRDOXPRTSC-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC(=C1)C=O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)