Products 1354940-77-4

CAS 1354940-77-4 is the registry number for 1-(5-Fluoropyridin-2-yl)ethan-1-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

1-(5-fluoro-2-pyridinyl)ethanone;hydrochloride (CAS 1354940-77-4) is a chemical compound with the molecular formula C7H7ClFNO and a molecular weight of 175.59 g/mol. IUPAC name: 1-(5-fluoro-2-pyridinyl)ethanone;hydrochloride. InChIKey: GSNPCCWOCZIAOY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClFNO
Molecular weight175.59 g/mol
IUPAC name1-(5-fluoro-2-pyridinyl)ethanone;hydrochloride
InChIKeyGSNPCCWOCZIAOY-UHFFFAOYSA-N
SMILESCC(=O)C1=NC=C(C=C1)F.Cl

Computed by PubChem (NCBI)