CAS 1354949-41-9 appears in our catalog under these names: 3-(2-Chloro-5-nitrophenyl)-1,3-oxazolidin-2-one, 95%, 3-(2-Chloro-5-nitrophenyl)-1,3-oxazolidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(2-chloro-5-nitrophenyl)-1,3-oxazolidin-2-one (CAS 1354949-41-9) is a chemical compound with the molecular formula C9H7ClN2O4 and a molecular weight of 242.61 g/mol. IUPAC name: 3-(2-chloro-5-nitrophenyl)-1,3-oxazolidin-2-one. InChIKey: RKGIRUZYDVEWJR-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O4 |
|---|---|
| Molecular weight | 242.61 g/mol |
| IUPAC name | 3-(2-chloro-5-nitrophenyl)-1,3-oxazolidin-2-one |
| InChIKey | RKGIRUZYDVEWJR-UHFFFAOYSA-N |
| SMILES | C1COC(=O)N1C2=C(C=CC(=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)