CAS 1354949-60-2 appears in our catalog under these names: 2-(4-Bromothiophen-2-yl)-2-(morpholin-4-yl)acetic acid hydrochloride, 2-(4-Bromothiophen-2-yl)-2-(morpholin-4-yl)acetic acid hydrochloride, 95%, 2-(4-Bromothiophen-2-yl)-2-(morpholin-4-yl)acetic acid hydrochloride, 98%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 50mg, 5g, 1g, 250mg.
2-(4-bromothiophen-2-yl)-2-morpholin-4-ylacetic acid;hydrochloride (CAS 1354949-60-2) is a chemical compound with the molecular formula C10H13BrClNO3S and a molecular weight of 342.64 g/mol. IUPAC name: 2-(4-bromothiophen-2-yl)-2-morpholin-4-ylacetic acid;hydrochloride. InChIKey: NTVQUQLTFYYKSX-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClNO3S |
|---|---|
| Molecular weight | 342.64 g/mol |
| IUPAC name | 2-(4-bromothiophen-2-yl)-2-morpholin-4-ylacetic acid;hydrochloride |
| InChIKey | NTVQUQLTFYYKSX-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(C2=CC(=CS2)Br)C(=O)O.Cl |
Computed by PubChem (NCBI)