Products 1354949-90-8

CAS 1354949-90-8 is the registry number for 4,4-Difluoropyrrolidine-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4,4-difluoropyrrolidine-2-carboxylic acid;hydrochloride (CAS 1354949-90-8) is a chemical compound with the molecular formula C5H8ClF2NO2 and a molecular weight of 187.57 g/mol. IUPAC name: 4,4-difluoropyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: QGRXWQRKPNNHMU-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8ClF2NO2
Molecular weight187.57 g/mol
IUPAC name4,4-difluoropyrrolidine-2-carboxylic acid;hydrochloride
InChIKeyQGRXWQRKPNNHMU-UHFFFAOYSA-N
SMILESC1C(NCC1(F)F)C(=O)O.Cl

Computed by PubChem (NCBI)