CAS 1354950-61-0 is the registry number for Pentafluorophenyl 4,5-dimethyl-1,3-thiazole-2-sulfonate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2,3,4,5,6-pentafluorophenyl) 4,5-dimethyl-1,3-thiazole-2-sulfonate (CAS 1354950-61-0) is a chemical compound with the molecular formula C11H6F5NO3S2 and a molecular weight of 359.3 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 4,5-dimethyl-1,3-thiazole-2-sulfonate. InChIKey: ATNXJJCJQJQEKA-UHFFFAOYSA-N.
| Molecular formula | C11H6F5NO3S2 |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 4,5-dimethyl-1,3-thiazole-2-sulfonate |
| InChIKey | ATNXJJCJQJQEKA-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)S(=O)(=O)OC2=C(C(=C(C(=C2F)F)F)F)F)C |
Computed by PubChem (NCBI)