CAS 1354951-65-7 appears in our catalog under these names: (4-Bromo-2,6-dichlorophenyl)hydrazine hydrochloride, 95%, (4-Bromo-2,6-dichlorophenyl)hydrazine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(4-bromo-2,6-dichlorophenyl)hydrazine;hydrochloride (CAS 1354951-65-7) is a chemical compound with the molecular formula C6H6BrCl3N2 and a molecular weight of 292.4 g/mol. IUPAC name: (4-bromo-2,6-dichlorophenyl)hydrazine;hydrochloride. InChIKey: NOPWHDDHOTUPLV-UHFFFAOYSA-N.
| Molecular formula | C6H6BrCl3N2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | (4-bromo-2,6-dichlorophenyl)hydrazine;hydrochloride |
| InChIKey | NOPWHDDHOTUPLV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)NN)Cl)Br.Cl |
Computed by PubChem (NCBI)