CAS 1354954-08-7 appears in our catalog under these names: 2,2,2-Trifluoroethyl N-(4-carbamoyl-3-chlorophenyl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(4-carbamoyl-3-chlorophenyl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2,2,2-trifluoroethyl N-(4-carbamoyl-3-chlorophenyl)carbamate (CAS 1354954-08-7) is a chemical compound with the molecular formula C10H8ClF3N2O3 and a molecular weight of 296.63 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(4-carbamoyl-3-chlorophenyl)carbamate. InChIKey: XRPPSSMKBWADFM-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3N2O3 |
|---|---|
| Molecular weight | 296.63 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(4-carbamoyl-3-chlorophenyl)carbamate |
| InChIKey | XRPPSSMKBWADFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)OCC(F)(F)F)Cl)C(=O)N |
Computed by PubChem (NCBI)