CAS 1354958-77-2 is the registry number for (3,4-Difluorophenyl)(3-methanesulfonylphenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3,4-difluorophenyl)-(3-methylsulfonylphenyl)methanamine;hydrochloride (CAS 1354958-77-2) is a chemical compound with the molecular formula C14H14ClF2NO2S and a molecular weight of 333.8 g/mol. IUPAC name: (3,4-difluorophenyl)-(3-methylsulfonylphenyl)methanamine;hydrochloride. InChIKey: QZOFOWDLPKMYLH-UHFFFAOYSA-N.
| Molecular formula | C14H14ClF2NO2S |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | (3,4-difluorophenyl)-(3-methylsulfonylphenyl)methanamine;hydrochloride |
| InChIKey | QZOFOWDLPKMYLH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C(C2=CC(=C(C=C2)F)F)N.Cl |
Computed by PubChem (NCBI)