CAS 1354963-50-0 appears in our catalog under these names: 2,2,2-Trifluoro-1-(trimethyl-1H-pyrazol-4-yl)ethan-1-amine hydrochloride, 95%, 2,2,2-Trifluoro-1-(trimethyl-1H-pyrazol-4-yl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine;hydrochloride (CAS 1354963-50-0) is a chemical compound with the molecular formula C8H13ClF3N3 and a molecular weight of 243.66 g/mol. IUPAC name: 2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine;hydrochloride. InChIKey: CYVBNHVCCJPPHI-UHFFFAOYSA-N.
| Molecular formula | C8H13ClF3N3 |
|---|---|
| Molecular weight | 243.66 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine;hydrochloride |
| InChIKey | CYVBNHVCCJPPHI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)