CAS 13551-89-8 is the registry number for Fluoromisonidazole, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
1-fluoro-3-(2-nitroimidazol-1-yl)propan-2-ol (CAS 13551-89-8) is a chemical compound with the molecular formula C6H8FN3O3 and a molecular weight of 189.14 g/mol. IUPAC name: 1-fluoro-3-(2-nitroimidazol-1-yl)propan-2-ol. InChIKey: HIIJZYSUEJYLMX-UHFFFAOYSA-N.
| Molecular formula | C6H8FN3O3 |
|---|---|
| Molecular weight | 189.14 g/mol |
| IUPAC name | 1-fluoro-3-(2-nitroimidazol-1-yl)propan-2-ol |
| InChIKey | HIIJZYSUEJYLMX-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=N1)[N+](=O)[O-])CC(CF)O |
Computed by PubChem (NCBI)