CAS 1355162-85-4 appears in our catalog under these names: (S,S)–1,2–Bis(t–butylmethylphosphino)benzene (S,S)–BenzP, (S,S)-(-)-1,2-Bis(t-butylmethylphosphino)benzene (S,S)-BenzP*, (S,S)-BenzP* 98%, (S,S)-BenzP, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
(S)-tert-butyl-[2-[tert-butyl(methyl)phosphanyl]phenyl]-methylphosphane (CAS 1355162-85-4) is a chemical compound with the molecular formula C16H28P2 and a molecular weight of 282.34 g/mol. IUPAC name: (S)-tert-butyl-[2-[tert-butyl(methyl)phosphanyl]phenyl]-methylphosphane. InChIKey: JFUWTGUCFKJVST-QZTJIDSGSA-N.
| Molecular formula | C16H28P2 |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | (S)-tert-butyl-[2-[tert-butyl(methyl)phosphanyl]phenyl]-methylphosphane |
| InChIKey | JFUWTGUCFKJVST-QZTJIDSGSA-N |
| SMILES | CC(C)(C)[P@](C)C1=CC=CC=C1[P@@](C)C(C)(C)C |
Computed by PubChem (NCBI)