Products 1355180-00-5
CAS 1355180-00-5 is the registry number for 3-(1-Methylpiperidin-4-yl)-3H-(1,2,3)triazolo(4,5-d)pyrimidine-5,7(4H,6H)-dione. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
3-(1-methylpiperidin-4-yl)-4H-triazolo[4,5-d]pyrimidine-5,7-dione (CAS 1355180-00-5) is a chemical compound with the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. IUPAC name: 3-(1-methylpiperidin-4-yl)-4H-triazolo[4,5-d]pyrimidine-5,7-dione. InChIKey: QXXCTZRCDGZKRX-UHFFFAOYSA-N.
| Molecular formula | C10H14N6O2 |
|---|---|
| Molecular weight | 250.26 g/mol |
| IUPAC name | 3-(1-methylpiperidin-4-yl)-4H-triazolo[4,5-d]pyrimidine-5,7-dione |
| InChIKey | QXXCTZRCDGZKRX-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)N2C3=C(C(=O)NC(=O)N3)N=N2 |
Computed by PubChem (NCBI)