Products 1355205-07-0

CAS 1355205-07-0 is the registry number for 5-Chloro-4-hydroxypyridine-3-sulfonic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-chloro-4-oxo-1H-pyridine-3-sulfonic acid (CAS 1355205-07-0) is a chemical compound with the molecular formula C5H4ClNO4S and a molecular weight of 209.61 g/mol. IUPAC name: 5-chloro-4-oxo-1H-pyridine-3-sulfonic acid. InChIKey: ZLVKWSLNEDFCNA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4ClNO4S
Molecular weight209.61 g/mol
IUPAC name5-chloro-4-oxo-1H-pyridine-3-sulfonic acid
InChIKeyZLVKWSLNEDFCNA-UHFFFAOYSA-N
SMILESC1=C(C(=O)C(=CN1)Cl)S(=O)(=O)O

Computed by PubChem (NCBI)