CAS 1355214-62-8 is the registry number for 1-(4-Bromo-1-ethyl-3-methyl-1H-pyrazol-5-yl)-N,N-dimethylmethanamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-N,N-dimethylmethanamine (CAS 1355214-62-8) is a chemical compound with the molecular formula C9H16BrN3 and a molecular weight of 246.15 g/mol. IUPAC name: 1-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-N,N-dimethylmethanamine. InChIKey: DNHBFAQNULILJI-UHFFFAOYSA-N.
| Molecular formula | C9H16BrN3 |
|---|---|
| Molecular weight | 246.15 g/mol |
| IUPAC name | 1-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-N,N-dimethylmethanamine |
| InChIKey | DNHBFAQNULILJI-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)Br)CN(C)C |
Computed by PubChem (NCBI)