CAS 1355246-88-6 is the registry number for 2-Chloro-4-(3,5-dichlorophenyl)benzonitrile, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-chloro-4-(3,5-dichlorophenyl)benzonitrile (CAS 1355246-88-6) is a chemical compound with the molecular formula C13H6Cl3N and a molecular weight of 282.5 g/mol. IUPAC name: 2-chloro-4-(3,5-dichlorophenyl)benzonitrile. InChIKey: NJTWONBGMKFTSO-UHFFFAOYSA-N.
| Molecular formula | C13H6Cl3N |
|---|---|
| Molecular weight | 282.5 g/mol |
| IUPAC name | 2-chloro-4-(3,5-dichlorophenyl)benzonitrile |
| InChIKey | NJTWONBGMKFTSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=CC(=C2)Cl)Cl)Cl)C#N |
Computed by PubChem (NCBI)