Products 1355247-16-3

CAS 1355247-16-3 is the registry number for 2-Chloro-4-(2-nitrophenyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-chloro-4-(2-nitrophenyl)benzoic acid (CAS 1355247-16-3) is a chemical compound with the molecular formula C13H8ClNO4 and a molecular weight of 277.66 g/mol. IUPAC name: 2-chloro-4-(2-nitrophenyl)benzoic acid. InChIKey: UZTSMTNERDSDHS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8ClNO4
Molecular weight277.66 g/mol
IUPAC name2-chloro-4-(2-nitrophenyl)benzoic acid
InChIKeyUZTSMTNERDSDHS-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC(=C(C=C2)C(=O)O)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)