CAS 1355247-80-1 is the registry number for 3-(3,5-Dichlorophenyl)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-(3,5-dichlorophenyl)aniline;hydrochloride (CAS 1355247-80-1) is a chemical compound with the molecular formula C12H10Cl3N and a molecular weight of 274.6 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)aniline;hydrochloride. InChIKey: ICZPFCOAVHBRNK-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl3N |
|---|---|
| Molecular weight | 274.6 g/mol |
| IUPAC name | 3-(3,5-dichlorophenyl)aniline;hydrochloride |
| InChIKey | ICZPFCOAVHBRNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC(=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)