CAS 1355248-21-3 is the registry number for 2-Chloro-4-(4-chloro-2-methoxyphenyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-chloro-4-(4-chloro-2-methoxyphenyl)benzonitrile (CAS 1355248-21-3) is a chemical compound with the molecular formula C14H9Cl2NO and a molecular weight of 278.1 g/mol. IUPAC name: 2-chloro-4-(4-chloro-2-methoxyphenyl)benzonitrile. InChIKey: AZFXYDIFIMKSMW-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NO |
|---|---|
| Molecular weight | 278.1 g/mol |
| IUPAC name | 2-chloro-4-(4-chloro-2-methoxyphenyl)benzonitrile |
| InChIKey | AZFXYDIFIMKSMW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C2=CC(=C(C=C2)C#N)Cl |
Computed by PubChem (NCBI)