CAS 135540-11-3 appears in our catalog under these names: 1–(Chloro–1–pyrrolidinylmethylene)pyrrolidinium hexafluorophosphate, 1-(Chloro-1-pyrrolidinylmethylene)pyrrolidinium Hexafluorophosphate, >97.0%(T), PyClU, PyClU 97%, CHLORODIPYRROLIDINOCARBENIUM HEXAFLUORO&. Offered by: GLPBio, TCI, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 10g, 25g, 5g, 250g, 500g, 1000g, 2000g.
1-[chloro(pyrrolidin-1-ium-1-ylidene)methyl]pyrrolidine hexafluorophosphate (CAS 135540-11-3) is a chemical compound with the molecular formula C9H16ClF6N2P and a molecular weight of 332.65 g/mol. IUPAC name: 1-[chloro(pyrrolidin-1-ium-1-ylidene)methyl]pyrrolidine hexafluorophosphate. InChIKey: NHEGCUSBUWGOQM-UHFFFAOYSA-N.
| Molecular formula | C9H16ClF6N2P |
|---|---|
| Molecular weight | 332.65 g/mol |
| IUPAC name | 1-[chloro(pyrrolidin-1-ium-1-ylidene)methyl]pyrrolidine hexafluorophosphate |
| InChIKey | NHEGCUSBUWGOQM-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=[N+]2CCCC2)Cl.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)