CAS 1355503-72-8 is the registry number for 3-(((2-Bromoallyl)(methyl)amino)methyl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-N-methylprop-2-en-1-amine (CAS 1355503-72-8) is a chemical compound with the molecular formula C9H16BrNO2S and a molecular weight of 282.20 g/mol. IUPAC name: 2-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-N-methylprop-2-en-1-amine. InChIKey: IUBWPUWMSHCAGW-UHFFFAOYSA-N.
| Molecular formula | C9H16BrNO2S |
|---|---|
| Molecular weight | 282.20 g/mol |
| IUPAC name | 2-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-N-methylprop-2-en-1-amine |
| InChIKey | IUBWPUWMSHCAGW-UHFFFAOYSA-N |
| SMILES | CN(CC1CCS(=O)(=O)C1)CC(=C)Br |
Computed by PubChem (NCBI)