CAS 1355621-03-2 is the registry number for 8-Chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline (CAS 1355621-03-2) is a chemical compound with the molecular formula C9H3ClF2N2O2 and a molecular weight of 244.58 g/mol. IUPAC name: 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline. InChIKey: GLGPWSRJLYZZFD-UHFFFAOYSA-N.
| Molecular formula | C9H3ClF2N2O2 |
|---|---|
| Molecular weight | 244.58 g/mol |
| IUPAC name | 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline |
| InChIKey | GLGPWSRJLYZZFD-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC3=C1OC(O3)(F)F)N=CN=C2Cl |
Computed by PubChem (NCBI)