CAS 1355681-10-5 appears in our catalog under these names: Ascr#18, Ascr#18, 98.0%, 98.0%, Ascr#18, 98.0%, Ascr#18 (Standard). Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 10mM/1mL, 1 mg, 10 mg, 5 mg, Get quote.
(10R)-10-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyundecanoic acid (CAS 1355681-10-5) is a chemical compound with the molecular formula C17H32O6 and a molecular weight of 332.4 g/mol. IUPAC name: (10R)-10-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyundecanoic acid. InChIKey: AHRWSOYISAIFOZ-JRBZFYFNSA-N.
| Molecular formula | C17H32O6 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | (10R)-10-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyundecanoic acid |
| InChIKey | AHRWSOYISAIFOZ-JRBZFYFNSA-N |
| SMILES | C[C@H]1[C@@H](C[C@H]([C@@H](O1)O[C@H](C)CCCCCCCCC(=O)O)O)O |
Computed by PubChem (NCBI)