CAS 1355881-46-7 is the registry number for 2-(4-(3,5-Dichloropyridin-2-yl)piperazin-1-yl)acetonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]acetonitrile (CAS 1355881-46-7) is a chemical compound with the molecular formula C11H12Cl2N4 and a molecular weight of 271.14 g/mol. IUPAC name: 2-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]acetonitrile. InChIKey: POIHOQMWCIJOKC-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N4 |
|---|---|
| Molecular weight | 271.14 g/mol |
| IUPAC name | 2-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]acetonitrile |
| InChIKey | POIHOQMWCIJOKC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC#N)C2=C(C=C(C=N2)Cl)Cl |
Computed by PubChem (NCBI)