CAS 1355990-07-6 appears in our catalog under these names: Treprostinil Ethyl Ester, Treprostinil Impurity 14, Treprostinil Ethyl Ester, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
Ethyl 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate (CAS 1355990-07-6) is a chemical compound with the molecular formula C25H38O5 and a molecular weight of 418.6 g/mol. IUPAC name: ethyl 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate. InChIKey: PBMHCIQUGUOGFB-KHYDEXNFSA-N.
| Molecular formula | C25H38O5 |
|---|---|
| Molecular weight | 418.6 g/mol |
| IUPAC name | ethyl 2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetate |
| InChIKey | PBMHCIQUGUOGFB-KHYDEXNFSA-N |
| SMILES | CCCCC[C@@H](CC[C@H]1[C@@H](C[C@H]2[C@@H]1CC3=C(C2)C(=CC=C3)OCC(=O)OCC)O)O |
Computed by PubChem (NCBI)