CAS 13560-91-3 is the registry number for NSC 91800. Offered by: TRC. Available pack sizes: 50mg, 5mg.
1,4,5,6,7,11,12,13,14,14,15,15-dodecachloropentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-5,12-diene (CAS 13560-91-3) is a chemical compound with the molecular formula C15H6Cl12 and a molecular weight of 611.6 g/mol. IUPAC name: 1,4,5,6,7,11,12,13,14,14,15,15-dodecachloropentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-5,12-diene. InChIKey: FUVVGRBPINDFIQ-UHFFFAOYSA-N.
| Molecular formula | C15H6Cl12 |
|---|---|
| Molecular weight | 611.6 g/mol |
| IUPAC name | 1,4,5,6,7,11,12,13,14,14,15,15-dodecachloropentacyclo[9.2.1.14,7.02,10.03,8]pentadeca-5,12-diene |
| InChIKey | FUVVGRBPINDFIQ-UHFFFAOYSA-N |
| SMILES | C1C2C(C3C1C4(C(=C(C3(C4(Cl)Cl)Cl)Cl)Cl)Cl)C5(C(=C(C2(C5(Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)