CAS 13560-99-1 is the registry number for Sodium 2-(2,4,5-trichlorophenoxy)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Sodium 2-(2,4,5-trichlorophenoxy)acetate (CAS 13560-99-1) is a chemical compound with the molecular formula C8H4Cl3NaO3 and a molecular weight of 277.5 g/mol. IUPAC name: sodium 2-(2,4,5-trichlorophenoxy)acetate. InChIKey: KXVMKVOQCMSZSZ-UHFFFAOYSA-M.
| Molecular formula | C8H4Cl3NaO3 |
|---|---|
| Molecular weight | 277.5 g/mol |
| IUPAC name | sodium 2-(2,4,5-trichlorophenoxy)acetate |
| InChIKey | KXVMKVOQCMSZSZ-UHFFFAOYSA-M |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)OCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)