Products 1356067-76-9
CAS 1356067-76-9 is the registry number for 5-bromo-2-(piperazin-1-yl)pyridine-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-bromo-2-piperazin-1-ylpyridine-3-carbonitrile (CAS 1356067-76-9) is a chemical compound with the molecular formula C10H11BrN4 and a molecular weight of 267.13 g/mol. IUPAC name: 5-bromo-2-piperazin-1-ylpyridine-3-carbonitrile. InChIKey: MVDFQHJUKFJREE-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN4 |
|---|---|
| Molecular weight | 267.13 g/mol |
| IUPAC name | 5-bromo-2-piperazin-1-ylpyridine-3-carbonitrile |
| InChIKey | MVDFQHJUKFJREE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=N2)Br)C#N |
Computed by PubChem (NCBI)