CAS 1356087-54-1 appears in our catalog under these names: 1-(4-Chloropyridin-2-yl)-2,2,2-trifluoroethyl trifluoromethanesulfonate, 95%, 1–(4–Chloropyridin–2–yl)–2,2,2–trifluoroethyl trifluoromethanesulfonate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 5g, 1g.
[1-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate (CAS 1356087-54-1) is a chemical compound with the molecular formula C8H4ClF6NO3S and a molecular weight of 343.63 g/mol. IUPAC name: [1-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate. InChIKey: UIGLSIWKRYUOJI-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF6NO3S |
|---|---|
| Molecular weight | 343.63 g/mol |
| IUPAC name | [1-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate |
| InChIKey | UIGLSIWKRYUOJI-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)C(C(F)(F)F)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)