CAS 1356113-09-1 is the registry number for ACETOXYETHYLTRIS(DIMETHYLAMINO)SILANE. Offered by: GLPBio. Available pack sizes: 10g.
2-[tris(dimethylamino)silyl]ethyl acetate (CAS 1356113-09-1) is a chemical compound with the molecular formula C10H25N3O2Si and a molecular weight of 247.41 g/mol. IUPAC name: 2-[tris(dimethylamino)silyl]ethyl acetate. InChIKey: DHKLXOYLHLFFPJ-UHFFFAOYSA-N.
| Molecular formula | C10H25N3O2Si |
|---|---|
| Molecular weight | 247.41 g/mol |
| IUPAC name | 2-[tris(dimethylamino)silyl]ethyl acetate |
| InChIKey | DHKLXOYLHLFFPJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC[Si](N(C)C)(N(C)C)N(C)C |
Computed by PubChem (NCBI)