CAS 13562-24-8 appears in our catalog under these names: 2,2,4-Trimethyl-4-phenyl-1,2,3,4-tetrahydroquinoline, 95%, 2,2,4-Trimethyl-4-phenyl-1,2,3,4-tetrahydroquinoline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2,2,4-trimethyl-4-phenyl-1,3-dihydroquinoline (CAS 13562-24-8) is a chemical compound with the molecular formula C18H21N and a molecular weight of 251.4 g/mol. IUPAC name: 2,2,4-trimethyl-4-phenyl-1,3-dihydroquinoline. InChIKey: OAKHEQUIFZCBFD-UHFFFAOYSA-N.
| Molecular formula | C18H21N |
|---|---|
| Molecular weight | 251.4 g/mol |
| IUPAC name | 2,2,4-trimethyl-4-phenyl-1,3-dihydroquinoline |
| InChIKey | OAKHEQUIFZCBFD-UHFFFAOYSA-N |
| SMILES | CC1(CC(C2=CC=CC=C2N1)(C)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)