CAS 135630-90-9 appears in our catalog under these names: Boc-dap(bromoacetyl)-oh, 95%, (S)-3-(2-Bromoacetamido)-2-((tert-butoxycarbonyl)amino)propanoic acid, 95+%, Boc-L-Dap(bromoacetyl)-OH. Offered by: Combi-blocks, AmBeed, Iris Biotech. Available pack sizes: 5g, 250mg, 1g.
(2S)-3-[(2-bromoacetyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 135630-90-9) is a chemical compound with the molecular formula C10H17BrN2O5 and a molecular weight of 325.16 g/mol. IUPAC name: (2S)-3-[(2-bromoacetyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CBCUCJIZACLGGN-LURJTMIESA-N.
| Molecular formula | C10H17BrN2O5 |
|---|---|
| Molecular weight | 325.16 g/mol |
| IUPAC name | (2S)-3-[(2-bromoacetyl)amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CBCUCJIZACLGGN-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CNC(=O)CBr)C(=O)O |
Computed by PubChem (NCBI)