CAS 1356339-26-8 appears in our catalog under these names: 1-tert-Butyl 3-ethyl 5,5-difluoropiperidine-1,3-dicarboxylate, 95%, 1-tert-Butyl 3-ethyl 5,5-difluoropiperidine-1,3-dicarboxylate, 97%, 1-tert-Butyl 3-ethyl 5,5-difluoropiperidine-1,3-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1-O-tert-butyl 3-O-ethyl 5,5-difluoropiperidine-1,3-dicarboxylate (CAS 1356339-26-8) is a chemical compound with the molecular formula C13H21F2NO4 and a molecular weight of 293.31 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 5,5-difluoropiperidine-1,3-dicarboxylate. InChIKey: WSFZFIOMRZLJIA-UHFFFAOYSA-N.
| Molecular formula | C13H21F2NO4 |
|---|---|
| Molecular weight | 293.31 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 5,5-difluoropiperidine-1,3-dicarboxylate |
| InChIKey | WSFZFIOMRZLJIA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(CN(C1)C(=O)OC(C)(C)C)(F)F |
Computed by PubChem (NCBI)