Products 1356497-92-1
CAS 1356497-92-1 is the registry number for PT-S58. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 3-[[4-(tert-butylamino)-2-methoxyphenyl]sulfamoyl]thiophene-2-carboxylate (CAS 1356497-92-1) is a chemical compound with the molecular formula C17H22N2O5S2 and a molecular weight of 398.5 g/mol. IUPAC name: methyl 3-[[4-(tert-butylamino)-2-methoxyphenyl]sulfamoyl]thiophene-2-carboxylate. InChIKey: JSUWAIOZKBYWCJ-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O5S2 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | methyl 3-[[4-(tert-butylamino)-2-methoxyphenyl]sulfamoyl]thiophene-2-carboxylate |
| InChIKey | JSUWAIOZKBYWCJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=CC(=C(C=C1)NS(=O)(=O)C2=C(SC=C2)C(=O)OC)OC |
Computed by PubChem (NCBI)