CAS 1356537-03-5 appears in our catalog under these names: Fmoc–Cit–OPfp, Fmoc-Cit-OPfp. Offered by: GLPBio, TRC, Biosynth. Available pack sizes: 5g, 500mg, 1g.
(2,3,4,5,6-pentafluorophenyl) 5-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate (CAS 1356537-03-5) is a chemical compound with the molecular formula C27H22F5N3O5 and a molecular weight of 563.5 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 5-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate. InChIKey: QTVBCSPTKLECIJ-UHFFFAOYSA-N.
| Molecular formula | C27H22F5N3O5 |
|---|---|
| Molecular weight | 563.5 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 5-(carbamoylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate |
| InChIKey | QTVBCSPTKLECIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCCNC(=O)N)C(=O)OC4=C(C(=C(C(=C4F)F)F)F)F |
Computed by PubChem (NCBI)