CAS 1356758-01-4 is the registry number for rac-(1R,3S)-3-Cyclopropylcyclohexan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-(1R,3S)-3-cyclopropylcyclohexan-1-amine;hydrochloride (CAS 1356758-01-4) is a chemical compound with the molecular formula C9H18ClN and a molecular weight of 175.70 g/mol. IUPAC name: cis-(1R,3S)-3-cyclopropylcyclohexan-1-amine;hydrochloride. InChIKey: BWKSMEMRIWRULY-OULXEKPRSA-N.
| Molecular formula | C9H18ClN |
|---|---|
| Molecular weight | 175.70 g/mol |
| IUPAC name | cis-(1R,3S)-3-cyclopropylcyclohexan-1-amine;hydrochloride |
| InChIKey | BWKSMEMRIWRULY-OULXEKPRSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)N)C2CC2.Cl |
Computed by PubChem (NCBI)