CAS 1356760-50-3 is the registry number for PKM2 modulator 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[5-[(4-fluorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]-3-phenyl-[1,2]oxazolo[5,4-b]pyridine (CAS 1356760-50-3) is a chemical compound with the molecular formula C21H13FN4O3 and a molecular weight of 388.4 g/mol. IUPAC name: 5-[5-[(4-fluorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]-3-phenyl-[1,2]oxazolo[5,4-b]pyridine. InChIKey: HQFFFVPSUMACPL-UHFFFAOYSA-N.
| Molecular formula | C21H13FN4O3 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 5-[5-[(4-fluorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]-3-phenyl-[1,2]oxazolo[5,4-b]pyridine |
| InChIKey | HQFFFVPSUMACPL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC3=C2C=C(C=N3)C4=NN=C(O4)COC5=CC=C(C=C5)F |
Computed by PubChem (NCBI)