Products 1356823-23-8

CAS 1356823-23-8 is the registry number for 3-Benzyloxyphenylboronic acid mida ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

6-methyl-2-(3-phenylmethoxyphenyl)-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1356823-23-8) is a chemical compound with the molecular formula C18H18BNO5 and a molecular weight of 339.2 g/mol. IUPAC name: 6-methyl-2-(3-phenylmethoxyphenyl)-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: MLLNEIFOFJQYGB-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18BNO5
Molecular weight339.2 g/mol
IUPAC name6-methyl-2-(3-phenylmethoxyphenyl)-1,3,6,2-dioxazaborocane-4,8-dione
InChIKeyMLLNEIFOFJQYGB-UHFFFAOYSA-N
SMILESB1(OC(=O)CN(CC(=O)O1)C)C2=CC(=CC=C2)OCC3=CC=CC=C3

Computed by PubChem (NCBI)