Products 1356834-62-2
CAS 1356834-62-2 appears in our catalog under these names: N-Me-aminopyrimidinone9/ 98.2% (existing batch purity), N-Me-aminopyrimidinone9, Nav1.7-IN-15. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
6-amino-2-[(4-tert-butylphenyl)methylsulfanyl]-3-methylpyrimidin-4-one (CAS 1356834-62-2) is a chemical compound with the molecular formula C16H21N3OS and a molecular weight of 303.4 g/mol. IUPAC name: 6-amino-2-[(4-tert-butylphenyl)methylsulfanyl]-3-methylpyrimidin-4-one. InChIKey: AJMIFZLEDTUBTN-UHFFFAOYSA-N.
| Molecular formula | C16H21N3OS |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 6-amino-2-[(4-tert-butylphenyl)methylsulfanyl]-3-methylpyrimidin-4-one |
| InChIKey | AJMIFZLEDTUBTN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CSC2=NC(=CC(=O)N2C)N |
Computed by PubChem (NCBI)