CAS 1356839-92-3 is the registry number for (trans)-4-Propyl-1-methyl-L-proline-d3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
(2S,4R)-4-propyl-1-(trideuteriomethyl)pyrrolidine-2-carboxylic acid (CAS 1356839-92-3) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 174.26 g/mol. IUPAC name: (2S,4R)-4-propyl-1-(trideuteriomethyl)pyrrolidine-2-carboxylic acid. InChIKey: MAWGMRQFCUEYCT-QTFNCCPBSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 174.26 g/mol |
| IUPAC name | (2S,4R)-4-propyl-1-(trideuteriomethyl)pyrrolidine-2-carboxylic acid |
| InChIKey | MAWGMRQFCUEYCT-QTFNCCPBSA-N |
| SMILES | [2H]C([2H])([2H])N1C[C@@H](C[C@H]1C(=O)O)CCC |
Computed by PubChem (NCBI)